ChemNet > CAS > 68208-19-5 3-Amino-3-(3-methoxyphenyl)propionic acid
68208-19-5 3-Amino-3-(3-methoxyphenyl)propionic acid
| product Name |
3-Amino-3-(3-methoxyphenyl)propionic acid |
| CAS No |
68208-19-5 |
| Synonyms |
(3S)-3-amino-3-(3-methoxyphenyl)propanoic acid; (3R)-3-amino-3-(3-methoxyphenyl)propanoic acid; 3-amino-3-(3-methoxyphenyl)propanoic acid |
| Molecular Formula |
C10H13NO3 |
| Molecular Weight |
195.2151 |
| InChI |
InChI=1/C10H13NO3/c1-14-8-4-2-3-7(5-8)9(11)6-10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13) |
| Molecular Structure |
|
| Density |
1.206g/cm3 |
| Boiling point |
350.2°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
165.6°C |
| Vapour Pressur |
1.66E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
