ChemNet > CAS > 68282-47-3 2-phenyl-1H-imidazole-4-carbaldehyde
68282-47-3 2-phenyl-1H-imidazole-4-carbaldehyde
| product Name |
2-phenyl-1H-imidazole-4-carbaldehyde |
| CAS No |
68282-47-3 |
| Synonyms |
2-phenyl-1H-imidazole-5-carbaldehyde |
| Molecular Formula |
C10H8N2O |
| Molecular Weight |
172.1833 |
| InChI |
InChI=1/C10H8N2O/c13-7-9-6-11-10(12-9)8-4-2-1-3-5-8/h1-7H,(H,11,12) |
| Molecular Structure |
|
| Density |
1.248g/cm3 |
| Melting point |
167℃ |
| Boiling point |
418.9°C at 760 mmHg |
| Refractive index |
1.646 |
| Flash point |
208.7°C |
| Vapour Pressur |
3.17E-07mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
