ChemNet > CAS > 68412-48-6 2-Propanone, reaction products with diphenylamine
68412-48-6 2-Propanone, reaction products with diphenylamine
| product Name |
2-Propanone, reaction products with diphenylamine |
| CAS No |
68412-48-6 |
| Synonyms |
Acetone diphenylamine condensation products; Acetone, diphenylamine condensation product; Diphenylamine, acetone reaction product; N-Phenylbenzeneamine, 2-propanone reaction product; propan-2-one-N-cyclohexylcyclohexanamine (1:1); propan-2-one-N-phenylaniline (1:1); Acetone Diphenylamine; Antioxidant BLE; Rubber Antioxidant BLE-W |
| Molecular Formula |
C15H17NO |
| Molecular Weight |
227.3016 |
| InChI |
InChI=1/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3 |
| EINECS |
270-192-0 |
| Molecular Structure |
|
| Boiling point |
302°C at 760 mmHg |
| Flash point |
152.8°C |
| Vapour Pressur |
0.00102mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
