ChemNet > CAS > 6848-13-1 3-Chloro-N,N-dimethylaniline
6848-13-1 3-Chloro-N,N-dimethylaniline
| product Name |
3-Chloro-N,N-dimethylaniline |
| CAS No |
6848-13-1 |
| Synonyms |
3-Chloro-NN-dimethylaniline |
| Molecular Formula |
C8H10ClN |
| Molecular Weight |
155.6247 |
| InChI |
InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| EINECS |
229-935-4 |
| Molecular Structure |
|
| Density |
1.117g/cm3 |
| Boiling point |
232.663°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
94.512°C |
| Vapour Pressur |
0.058mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
