6853-57-2 p-Pentylbenzaldehyde
product Name |
p-Pentylbenzaldehyde |
CAS No |
6853-57-2 |
Synonyms |
4-pentylbenzaldehyde |
Molecular Formula |
C12H16O |
Molecular Weight |
176.2548 |
InChI |
InChI=1/C12H16O/c1-2-3-4-5-11-6-8-12(10-13)9-7-11/h6-10H,2-5H2,1H3 |
Molecular Structure |
|
Density |
0.96g/cm3 |
Boiling point |
275.3°C at 760 mmHg |
Refractive index |
1.527 |
Flash point |
109.9°C |
Vapour Pressur |
0.00514mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|