ChemNet > CAS > 68585-05-7 Octadecanoic acid, reaction products with diethylenetriamine, di-Et sulfate-quaternized
68585-05-7 Octadecanoic acid, reaction products with diethylenetriamine, di-Et sulfate-quaternized
| product Name |
Octadecanoic acid, reaction products with diethylenetriamine, di-Et sulfate-quaternized |
| CAS No |
68585-05-7 |
| Synonyms |
Quaternized stearic imidazoline amide; Reaction products of stearic acid with diethylenetriamine, diethyl sulfate quaternized; N-(2-aminoethyl)ethane-1,2-diamine; diethyl sulfate; stearic acid |
| Molecular Formula |
C26H59N3O6S |
| Molecular Weight |
541.8282 |
| InChI |
InChI=1/C18H36O2.C4H13N3.C4H10O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;1-3-7-9(5,6)8-4-2/h2-17H2,1H3,(H,19,20);7H,1-6H2;3-4H2,1-2H3 |
| EINECS |
271-548-8 |
| Molecular Structure |
|
| Boiling point |
359.4°C at 760 mmHg |
| Flash point |
162.4°C |
| Vapour Pressur |
8.58E-06mmHg at 25°C |
|