ChemNet > CAS > 68983-70-0 1-(4-Methylphenyl)-1-cyclopentanecarbonitrile
68983-70-0 1-(4-Methylphenyl)-1-cyclopentanecarbonitrile
| product Name |
1-(4-Methylphenyl)-1-cyclopentanecarbonitrile |
| CAS No |
68983-70-0 |
| Synonyms |
1-(p-Tolyl)-1-cyclopentanecarbonitrile; 1-(4-methylphenyl)cyclopentanecarbonitrile |
| Molecular Formula |
C13H15N |
| Molecular Weight |
185.2649 |
| InChI |
InChI=1/C13H15N/c1-11-4-6-12(7-5-11)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| EINECS |
273-487-2 |
| Molecular Structure |
|
| Density |
1.02g/cm3 |
| Boiling point |
326.2°C at 760 mmHg |
| Refractive index |
1.546 |
| Flash point |
121.3°C |
| Vapour Pressur |
0.000219mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
