ChemNet > CAS > 69038-81-9 2-Ethoxycinnamic acid
69038-81-9 2-Ethoxycinnamic acid
| product Name |
2-Ethoxycinnamic acid |
| CAS No |
69038-81-9 |
| Synonyms |
(2E)-3-(2-ethoxyphenyl)prop-2-enoic acid |
| Molecular Formula |
C11H12O3 |
| Molecular Weight |
192.2112 |
| InChI |
InChI=1/C11H12O3/c1-2-14-10-6-4-3-5-9(10)7-8-11(12)13/h3-8H,2H2,1H3,(H,12,13)/b8-7+ |
| Molecular Structure |
|
| Density |
1.161g/cm3 |
| Melting point |
134-138℃ |
| Boiling point |
337.2°C at 760 mmHg |
| Refractive index |
1.579 |
| Flash point |
131.7°C |
| Vapour Pressur |
4.18E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
