ChemNet > CAS > 6926-51-8 5-(4-Methoxyphenyl)-1H-tetrazole
6926-51-8 5-(4-Methoxyphenyl)-1H-tetrazole
| product Name |
5-(4-Methoxyphenyl)-1H-tetrazole |
| CAS No |
6926-51-8 |
| Synonyms |
5-(4-methoxyphenyl)-2H-tetrazole |
| Molecular Formula |
C8H8N4O |
| Molecular Weight |
176.1753 |
| InChI |
InChI=1/C8H8N4O/c1-13-7-4-2-6(3-5-7)8-9-11-12-10-8/h2-5H,1H3,(H,9,10,11,12) |
| Molecular Structure |
|
| Density |
1.288g/cm3 |
| Boiling point |
365.2°C at 760 mmHg |
| Refractive index |
1.591 |
| Flash point |
133.2°C |
| Vapour Pressur |
1.6E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
