ChemNet > CAS > 693-55-0 Ethyl hydrogen sebacate
693-55-0 Ethyl hydrogen sebacate
| product Name |
Ethyl hydrogen sebacate |
| CAS No |
693-55-0 |
| Synonyms |
Monoethyl sebacate~Sebacic acid monoethyl ester; monoethyl sebacate; Decanedioic acid monoethyl ester~Monoethyl sebacate~Sebacic acid monoethyl ester; 10-ethoxy-10-oxodecanoic acid |
| Molecular Formula |
C12H22O4 |
| Molecular Weight |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-2-16-12(15)10-8-6-4-3-5-7-9-11(13)14/h2-10H2,1H3,(H,13,14) |
| EINECS |
211-753-1 |
| Molecular Structure |
|
| Density |
1.024g/cm3 |
| Boiling point |
336°C at 760 mmHg |
| Refractive index |
1.455 |
| Flash point |
119°C |
| Vapour Pressur |
2.17E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
