ChemNet > CAS > 6937-16-2 ethyl 4-aminobutyrate hydrochloride
6937-16-2 ethyl 4-aminobutyrate hydrochloride
| product Name |
ethyl 4-aminobutyrate hydrochloride |
| CAS No |
6937-16-2 |
| Synonyms |
4-aminobutyrate ethyl hydrochloride; 4-Aminobutyric acid ethyl ester hydrochloride; Ethyl4-aminobutyratehydrochloride,(4-Aminobutyricacidethylesterhydrochloride); 4-ethoxy-4-oxobutan-1-aminium chloride; ethyl 4-aminobutanoate |
| Molecular Formula |
C6H13NO2 |
| Molecular Weight |
131.1729 |
| InChI |
InChI=1/C6H13NO2/c1-2-9-6(8)4-3-5-7/h2-5,7H2,1H3 |
| EINECS |
230-063-1 |
| Molecular Structure |
|
| Density |
0.973g/cm3 |
| Melting point |
89-91℃ |
| Boiling point |
182.1°C at 760 mmHg |
| Refractive index |
1.434 |
| Flash point |
54.5°C |
| Vapour Pressur |
0.826mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
