ChemNet > CAS > 6937-34-4 3-iodophthalic acid
6937-34-4 3-iodophthalic acid
| product Name |
3-iodophthalic acid |
| CAS No |
6937-34-4 |
| Synonyms |
3-iodobenzene-1,2-dicarboxylic acid; 3-Iodophthaltc acid |
| Molecular Formula |
C8H5IO4 |
| Molecular Weight |
292.0274 |
| InChI |
InChI=1/C8H5IO4/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| Molecular Structure |
|
| Density |
2.138g/cm3 |
| Melting point |
232℃ |
| Boiling point |
426.3°C at 760 mmHg |
| Refractive index |
1.704 |
| Flash point |
211.6°C |
| Vapour Pressur |
5.01E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
