ChemNet > CAS > 696-82-2 2,4,6-trifluoropyrimidine
696-82-2 2,4,6-trifluoropyrimidine
| product Name |
2,4,6-trifluoropyrimidine |
| CAS No |
696-82-2 |
| Synonyms |
2,4,6-Trifluoropyrimidine |
| Molecular Formula |
C4HF3N2 |
| Molecular Weight |
134.0593 |
| InChI |
InChI=1/C4HF3N2/c5-2-1-3(6)9-4(7)8-2/h1H |
| EINECS |
211-801-1 |
| Molecular Structure |
|
| Density |
1.514g/cm3 |
| Boiling point |
195.6°C at 760 mmHg |
| Refractive index |
1.42 |
| Flash point |
72.1°C |
| Vapour Pressur |
0.584mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
R37:Irritating to respiratory system.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
