ChemNet > CAS > 6960-22-1 6-Methylnicotinamide
6960-22-1 6-Methylnicotinamide
| product Name |
6-Methylnicotinamide |
| Synonyms |
6-Methylpyridine-3-carboxamide |
| Molecular Formula |
C7H8N2O |
| Molecular Weight |
136.1512 |
| InChI |
InChI=1/C7H8N2O/c1-5-2-3-6(4-9-5)7(8)10/h2-4H,1H3,(H2,8,10) |
| CAS Registry Number |
6960-22-1 |
| Molecular Structure |
|
| Density |
1.157g/cm3 |
| Melting point |
196-198℃ |
| Boiling point |
289.4°C at 760 mmHg |
| Refractive index |
1.561 |
| Flash point |
128.8°C |
| Vapour Pressur |
0.00221mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
