ChemNet > CAS > 6967-29-9 2-Chloro-N-(2,6-diethylphenyl)-acetamide
6967-29-9 2-Chloro-N-(2,6-diethylphenyl)-acetamide
| product Name |
2-Chloro-N-(2,6-diethylphenyl)-acetamide |
| CAS No |
6967-29-9 |
| Synonyms |
N-Chloroacetyl-2,6-diethylaniline; alpha-Chloro-2,6-diethylacetanilide |
| Molecular Formula |
C12H16ClNO |
| Molecular Weight |
225.7145 |
| InChI |
InChI=1/C12H16ClNO/c1-3-9-6-5-7-10(4-2)12(9)14-11(15)8-13/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
| Molecular Structure |
|
| Density |
1.131g/cm3 |
| Boiling point |
369.2°C at 760 mmHg |
| Refractive index |
1.559 |
| Flash point |
177.1°C |
| Vapour Pressur |
1.2E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
