ChemNet > CAS > 6968-28-1 4-bromophthalic acid
6968-28-1 4-bromophthalic acid
| product Name |
4-bromophthalic acid |
| CAS No |
6968-28-1 |
| Synonyms |
4-Bromo-1,2-benzenedicarboxylic Acid; 4-bromobenzene-1,2-dicarboxylic acid; 4-bromobenzene-1,2-dicarboxylate |
| Molecular Formula |
C8H3BrO4 |
| Molecular Weight |
243.0121 |
| InChI |
InChI=1/C8H5BrO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13)/p-2 |
| EINECS |
230-183-4 |
| Molecular Structure |
|
| Boiling point |
412.4°C at 760 mmHg |
| Flash point |
203.2°C |
| Vapour Pressur |
1.54E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
