ChemNet > CAS > 69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
| product Name |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
| CAS No |
69687-80-5 |
| Synonyms |
Methyl 2,5-dimethylpyrrole-3-carboxylate |
| Molecular Formula |
C8H11NO2 |
| Molecular Weight |
153.1784 |
| InChI |
InChI=1/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 |
| Molecular Structure |
|
| Density |
1.108g/cm3 |
| Melting point |
115℃ |
| Boiling point |
294.3°C at 760 mmHg |
| Refractive index |
1.521 |
| Flash point |
131.8°C |
| Vapour Pressur |
0.00163mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
