ChemNet > CAS > 6972-51-6 2,5-Dimethylphenethylalcohol
6972-51-6 2,5-Dimethylphenethylalcohol
| product Name |
2,5-Dimethylphenethylalcohol |
| CAS No |
6972-51-6 |
| Synonyms |
2,5-Dimethylphenethyl alcohol; 2-(2,5-dimethylphenyl)ethanol |
| Molecular Formula |
C10H14O |
| Molecular Weight |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-8-3-4-9(2)10(7-8)5-6-11/h3-4,7,11H,5-6H2,1-2H3 |
| Molecular Structure |
|
| Density |
0.986g/cm3 |
| Boiling point |
267.6°C at 760 mmHg |
| Refractive index |
1.529 |
| Flash point |
126°C |
| Vapour Pressur |
0.00401mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
