ChemNet > CAS > 6972-71-0 4,5-Dimethyl-2-nitroaniline
6972-71-0 4,5-Dimethyl-2-nitroaniline
| product Name |
4,5-Dimethyl-2-nitroaniline |
| CAS No |
6972-71-0 |
| Synonyms |
2-Nitro-4,5-Dimethyl Aniline; 6-Nitro-3,4-xylidine |
| Molecular Formula |
C8H10N2O2 |
| Molecular Weight |
166.1772 |
| InChI |
InChI=1/C8H10N2O2/c1-5-3-7(9)8(10(11)12)4-6(5)2/h3-4H,9H2,1-2H3 |
| EINECS |
230-211-5 |
| Molecular Structure |
|
| Density |
1.22g/cm3 |
| Melting point |
138-143℃ |
| Boiling point |
335.7°C at 760 mmHg |
| Refractive index |
1.601 |
| Flash point |
156.8°C |
| Vapour Pressur |
0.000118mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
