ChemNet > CAS > 6973-77-9 N-(1-Naphthyl)maleamic acid
6973-77-9 N-(1-Naphthyl)maleamic acid
| product Name |
N-(1-Naphthyl)maleamic acid |
| CAS No |
6973-77-9 |
| Synonyms |
N-(1-Naphthyl)maleamic acid; (2Z)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoic acid |
| Molecular Formula |
C14H11NO3 |
| Molecular Weight |
241.242 |
| InChI |
InChI=1/C14H11NO3/c16-13(8-9-14(17)18)15-12-7-3-5-10-4-1-2-6-11(10)12/h1-9H,(H,15,16)(H,17,18)/b9-8- |
| Molecular Structure |
|
| Density |
1.356g/cm3 |
| Boiling point |
533.9°C at 760 mmHg |
| Refractive index |
1.706 |
| Flash point |
276.7°C |
| Vapour Pressur |
3.15E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
