ChemNet > CAS > 69778-83-2 4-Methoxy-3-pyrrolin-2-one
69778-83-2 4-Methoxy-3-pyrrolin-2-one
| product Name |
4-Methoxy-3-pyrrolin-2-one |
| CAS No |
69778-83-2 |
| Synonyms |
1,5-Dihydro-4-methoxy-2H-pyrrol-2-on; 4-methoxy-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Formula |
C5H7NO2 |
| Molecular Weight |
113.1146 |
| InChI |
InChI=1/C5H7NO2/c1-8-4-2-5(7)6-3-4/h2H,3H2,1H3,(H,6,7) |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Melting point |
130-133℃ |
| Boiling point |
349.6°C at 760 mmHg |
| Refractive index |
1.495 |
| Flash point |
165.2°C |
| Vapour Pressur |
4.65E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
