ChemNet > CAS > 698-29-3 4-amino-2-methylpyrimidine-5-carbonitrile
698-29-3 4-amino-2-methylpyrimidine-5-carbonitrile
| product Name |
4-amino-2-methylpyrimidine-5-carbonitrile |
| CAS No |
698-29-3 |
| Synonyms |
4-Amino-5-cyano-2-methylpyrimidine |
| Molecular Formula |
C6H6N4 |
| Molecular Weight |
134.14 |
| InChI |
InChI=1/C6H6N4/c1-4-9-3-5(2-7)6(8)10-4/h3H,1H3,(H2,8,9,10) |
| EINECS |
211-814-2 |
| Molecular Structure |
|
| Melting point |
249℃ |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
