ChemNet > CAS > 698-90-8 cyclohexylurea
698-90-8 cyclohexylurea
| product Name |
cyclohexylurea |
| CAS No |
698-90-8 |
| Synonyms |
N-CYCLOHEXLUREA; 1-Cyclohexylurea; N-Cyclohexylurea; Cyclohexyl-ure |
| Molecular Formula |
C7H14N2O |
| Molecular Weight |
142.1989 |
| InChI |
InChI=1/C7H14N2O/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9,10) |
| EINECS |
211-822-6 |
| Molecular Structure |
|
| Density |
1.05g/cm3 |
| Boiling point |
240.3°C at 760 mmHg |
| Refractive index |
1.5 |
| Flash point |
99.2°C |
| Vapour Pressur |
0.0381mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
