ChemNet > CAS > 699-18-3 2-(2-nitrovinyl)furan
699-18-3 2-(2-nitrovinyl)furan
| product Name |
2-(2-nitrovinyl)furan |
| CAS No |
699-18-3 |
| Synonyms |
|
| Molecular Formula |
C6H5NO3 |
| Molecular Weight |
139.11 |
| InChI |
InChI=1/C6H5NO3/c8-7(9)4-3-6-2-1-5-10-6/h1-5H/b4-3+ |
| Molecular Structure |
|
| Melting point |
72-75℃ |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
