ChemNet > CAS > 70-57-5 5-Methylnicotinamide
70-57-5 5-Methylnicotinamide
| product Name |
5-Methylnicotinamide |
| CAS No |
70-57-5 |
| Synonyms |
5-Methylpyridine-3-carboxamide |
| Molecular Formula |
C7H8N2O |
| Molecular Weight |
136.1512 |
| InChI |
InChI=1/C7H8N2O/c1-5-2-6(7(8)10)4-9-3-5/h2-4H,1H3,(H2,8,10) |
| Molecular Structure |
|
| Density |
1.157g/cm3 |
| Boiling point |
290°C at 760 mmHg |
| Refractive index |
1.561 |
| Flash point |
129.2°C |
| Vapour Pressur |
0.00213mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
