70-57-5 5-Methylnicotinamide
product Name |
5-Methylnicotinamide |
CAS No |
70-57-5 |
Synonyms |
5-Methylpyridine-3-carboxamide |
Molecular Formula |
C7H8N2O |
Molecular Weight |
136.1512 |
InChI |
InChI=1/C7H8N2O/c1-5-2-6(7(8)10)4-9-3-5/h2-4H,1H3,(H2,8,10) |
Molecular Structure |
|
Density |
1.157g/cm3 |
Boiling point |
290°C at 760 mmHg |
Refractive index |
1.561 |
Flash point |
129.2°C |
Vapour Pressur |
0.00213mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|