ChemNet > CAS > 70-69-9 4'-Aminopropiophenone
70-69-9 4'-Aminopropiophenone
| product Name |
4'-Aminopropiophenone |
| CAS No |
70-69-9 |
| Synonyms |
4-Aminopropiophenone; para-Aminopropiophenone; p-Aminopropiophenone |
| Molecular Formula |
C9H11NO |
| Molecular Weight |
149.1897 |
| InChI |
InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| EINECS |
200-742-7 |
| Molecular Structure |
|
| Density |
1.067g/cm3 |
| Melting point |
137-143℃ |
| Boiling point |
305.8°C at 760 mmHg |
| Refractive index |
1.559 |
| Flash point |
138.7°C |
| Vapour Pressur |
0.000805mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
