ChemNet > CAS > 703-59-3 Homophthalic anhydride
703-59-3 Homophthalic anhydride
| product Name |
Homophthalic anhydride |
| CAS No |
703-59-3 |
| Synonyms |
1,3-Isochromandione; benzoglutaric anhydride; 1H-isochromene-1,3(4H)-dione; o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione |
| Molecular Formula |
C9H6O3 |
| Molecular Weight |
162.1421 |
| InChI |
InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
| EINECS |
211-873-4 |
| Molecular Structure |
|
| Density |
1.347g/cm3 |
| Melting point |
140-144℃ |
| Boiling point |
324.5°C at 760 mmHg |
| Refractive index |
1.584 |
| Flash point |
159°C |
| Vapour Pressur |
0.000244mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
