ChemNet > CAS > 704-38-1 Bis(2-thienyl) ketone
704-38-1 Bis(2-thienyl) ketone
| product Name |
Bis(2-thienyl) ketone |
| CAS No |
704-38-1 |
| Synonyms |
Di-2-thienyl ketone; Bis(2-thienyl)ketone~Di-2-thienyl ketone; dithiophen-2-ylmethanone |
| Molecular Formula |
C9H6OS2 |
| Molecular Weight |
194.2733 |
| InChI |
InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
| Molecular Structure |
|
| Density |
1.326g/cm3 |
| Melting point |
89-91℃ |
| Boiling point |
323°C at 760 mmHg |
| Refractive index |
1.64 |
| Flash point |
149.1°C |
| Vapour Pressur |
0.00027mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
