704-38-1 Bis(2-thienyl) ketone
product Name |
Bis(2-thienyl) ketone |
CAS No |
704-38-1 |
Synonyms |
Di-2-thienyl ketone; Bis(2-thienyl)ketone~Di-2-thienyl ketone; dithiophen-2-ylmethanone |
Molecular Formula |
C9H6OS2 |
Molecular Weight |
194.2733 |
InChI |
InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
Molecular Structure |
|
Density |
1.326g/cm3 |
Melting point |
89-91℃ |
Boiling point |
323°C at 760 mmHg |
Refractive index |
1.64 |
Flash point |
149.1°C |
Vapour Pressur |
0.00027mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|