ChemNet > CAS > 7073-94-1 1-Bromo-2-isopropylbenzene
7073-94-1 1-Bromo-2-isopropylbenzene
| product Name |
1-Bromo-2-isopropylbenzene |
| CAS No |
7073-94-1 |
| Synonyms |
2-Bromocumene; 2-Isopropylbromobenzene; 1-bromo-2-(propan-2-yl)benzene; 1-Bromo-2-isopropyl benzene; 2-bromo isopropyl benzene; 2-Bromoisopropylbenzene; 1-Bromo-2-(1-Methylethyl)Benzene |
| Molecular Formula |
C9H11Br |
| Molecular Weight |
199.0876 |
| InChI |
InChI=1/C9H11Br/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,1-2H3 |
| EINECS |
230-370-0 |
| Molecular Structure |
|
| Density |
1.278g/cm3 |
| Boiling point |
210.2°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
81.6°C |
| Vapour Pressur |
0.282mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
