ChemNet > CAS > 709-09-1 1,2-Dimethoxy-4-nitrobenzene
709-09-1 1,2-Dimethoxy-4-nitrobenzene
| product Name |
1,2-Dimethoxy-4-nitrobenzene |
| Synonyms |
4-Nitroveratrole; 1,2-dimethoxy-4-nitro-benzen; 3,4-Dimethoxynitrobenzene; 4-Nitrcveratrole; 4-NITRO-1,2-DIMETHOXYBENZENE; Benzene, 1,2-dimethoxy-4-nitro-; 3,4-dimethoxy-nitrobenzene |
| Molecular Formula |
C8H7IO2 |
| Molecular Weight |
262.0444 |
| InChI |
InChI=1/C8H7IO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11) |
| CAS Registry Number |
709-09-1 |
| EINECS |
211-906-2 |
| Molecular Structure |
|
| Density |
1.867g/cm3 |
| Melting point |
95-98℃ |
| Boiling point |
355.2°C at 760 mmHg |
| Refractive index |
1.645 |
| Flash point |
168.6°C |
| Vapour Pressur |
1.16E-05mmHg at 25°C |
| Hazard Symbols |
 Xn,Xi:;
|
| Risk Codes |
22:;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
1,2-Dimethoxy-4-nitrobenzene Material Safety Data Sheet
|
|
