ChemNet > CAS > 71022-43-0 3,5-Dinitrobenzyl alcohol
71022-43-0 3,5-Dinitrobenzyl alcohol
| product Name |
3,5-Dinitrobenzyl alcohol |
| CAS No |
71022-43-0 |
| Synonyms |
(3,5-dinitrophenyl)methanol |
| Molecular Formula |
C7H6N2O5 |
| Molecular Weight |
198.1329 |
| InChI |
InChI=1/C7H6N2O5/c10-4-5-1-6(8(11)12)3-7(2-5)9(13)14/h1-3,10H,4H2 |
| EINECS |
275-131-1 |
| Molecular Structure |
|
| Density |
1.56g/cm3 |
| Melting point |
88-92℃ |
| Boiling point |
404.2°C at 760 mmHg |
| Refractive index |
1.641 |
| Flash point |
183.7°C |
| Vapour Pressur |
2.94E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
