ChemNet > CAS > 71083-06-2 Ethyl 1,4-dihydro-8-fluoro-4-oxoquinoline-3-carboxylate
71083-06-2 Ethyl 1,4-dihydro-8-fluoro-4-oxoquinoline-3-carboxylate
| product Name |
Ethyl 1,4-dihydro-8-fluoro-4-oxoquinoline-3-carboxylate |
| CAS No |
71083-06-2 |
| Synonyms |
Ethyl 8-fluoro-4-hydroxyquinoline-3-; Ethyl 8-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate; [chloro(fluoro)methyl]benzene |
| Molecular Formula |
C7H6ClF |
| Molecular Weight |
144.5739 |
| InChI |
InChI=1/C7H6ClF/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| Molecular Structure |
|
| Density |
1.172g/cm3 |
| Melting point |
217-219℃ |
| Boiling point |
166.1°C at 760 mmHg |
| Refractive index |
1.498 |
| Flash point |
53.7°C |
| Vapour Pressur |
2.38mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
