ChemNet > CAS > 712-97-0 6-Nitropiperonal
712-97-0 6-Nitropiperonal
| product Name |
6-Nitropiperonal |
| CAS No |
712-97-0 |
| Synonyms |
(3,4-Methylenedioxy-6-nitrobenzald; 4,5-Methylenedioxy-2-nitrobenzaldehyde; 6-Nitro-1,3-benzodioxole-5-carboxaldehyde; 6-nitro-1,3-benzodioxole-5-carbaldehyde; 4,5-(Methylenedioxy)-2-nitrobenzaldehyde |
| Molecular Formula |
C8H5NO5 |
| Molecular Weight |
195.129 |
| InChI |
InChI=1/C8H5NO5/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12/h1-3H,4H2 |
| EINECS |
211-926-1 |
| Molecular Structure |
|
| Density |
1.572g/cm3 |
| Melting point |
93-96℃ |
| Boiling point |
365.9°C at 760 mmHg |
| Refractive index |
1.658 |
| Flash point |
195°C |
| Vapour Pressur |
1.52E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
