ChemNet > CAS > 7145-82-6 2,4,6-Trichloroiodobenzene
7145-82-6 2,4,6-Trichloroiodobenzene
| product Name |
2,4,6-Trichloroiodobenzene |
| CAS No |
7145-82-6 |
| Synonyms |
2,4,5-Trichloroiodobenzene; 1-Iodo-2,4,5-trichlorobenzene; 1,2,4-trichloro-5-iodobenzene |
| Molecular Formula |
C6H2Cl3I |
| Molecular Weight |
307.3435 |
| InChI |
InChI=1/C6H2Cl3I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| Molecular Structure |
|
| Density |
2.085g/cm3 |
| Melting point |
56-58℃ |
| Boiling point |
292.8°C at 760 mmHg |
| Refractive index |
1.651 |
| Flash point |
130.9°C |
| Vapour Pressur |
0.00314mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
