ChemNet > CAS > 71463-55-3 1-(2,4-Dichlorophenyl)-1-cyclopropyl cyanide
71463-55-3 1-(2,4-Dichlorophenyl)-1-cyclopropyl cyanide
| product Name |
1-(2,4-Dichlorophenyl)-1-cyclopropyl cyanide |
| CAS No |
71463-55-3 |
| Synonyms |
1-(2,4-Dichlorophenyl)cyclopropanecarbonitrile |
| Molecular Formula |
C10H7Cl2N |
| Molecular Weight |
212.0753 |
| InChI |
InChI=1/C10H7Cl2N/c11-7-1-2-8(9(12)5-7)10(6-13)3-4-10/h1-2,5H,3-4H2 |
| EINECS |
275-494-6 |
| Molecular Structure |
|
| Density |
1.38g/cm3 |
| Melting point |
81-85℃ |
| Boiling point |
337.4°C at 760 mmHg |
| Refractive index |
1.604 |
| Flash point |
149.5°C |
| Vapour Pressur |
0.000105mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
