ChemNet > CAS > 7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
| product Name |
1,3-dichloro-2-methyl-5-nitrobenzene |
| CAS No |
7149-69-1 |
| Synonyms |
2,6-Dichloro-4-nitrotoluene |
| Molecular Formula |
C7H5Cl2NO2 |
| Molecular Weight |
206.0261 |
| InChI |
InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
| Molecular Structure |
|
| Density |
1.456g/cm3 |
| Melting point |
62℃ |
| Boiling point |
279.6°C at 760 mmHg |
| Refractive index |
1.585 |
| Flash point |
122.9°C |
| Vapour Pressur |
0.00674mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
