ChemNet > CAS > 71501-44-5 1-(4-Chlorophenyl)-1-cyclopentanecarbonylchloride
71501-44-5 1-(4-Chlorophenyl)-1-cyclopentanecarbonylchloride
| product Name |
1-(4-Chlorophenyl)-1-cyclopentanecarbonylchloride |
| CAS No |
71501-44-5 |
| Synonyms |
1-(4-Chlorophenyl)cyclopentanecarbonyl chloride |
| Molecular Formula |
C12H12Cl2O |
| Molecular Weight |
243.1291 |
| InChI |
InChI=1/C12H12Cl2O/c13-10-5-3-9(4-6-10)12(11(14)15)7-1-2-8-12/h3-6H,1-2,7-8H2 |
| EINECS |
275-573-5 |
| Molecular Structure |
|
| Density |
1.283g/cm3 |
| Boiling point |
315.8°C at 760 mmHg |
| Refractive index |
1.565 |
| Flash point |
126.3°C |
| Vapour Pressur |
0.000428mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
