ChemNet > CAS > 7152-04-7 4-Acetamidocinnamic acid
7152-04-7 4-Acetamidocinnamic acid
| product Name |
4-Acetamidocinnamic acid |
| CAS No |
7152-04-7 |
| Synonyms |
(2E)-3-[4-(acetylamino)phenyl]prop-2-enoic acid |
| Molecular Formula |
C11H11NO3 |
| Molecular Weight |
205.2099 |
| InChI |
InChI=1/C11H11NO3/c1-8(13)12-10-5-2-9(3-6-10)4-7-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15)/b7-4+ |
| Molecular Structure |
|
| Density |
1.297g/cm3 |
| Boiling point |
470.9°C at 760 mmHg |
| Refractive index |
1.654 |
| Flash point |
238.6°C |
| Vapour Pressur |
1.13E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
