7162-59-6 o-Hexyloxybenzaldehyde
product Name |
o-Hexyloxybenzaldehyde |
CAS No |
7162-59-6 |
Synonyms |
2-n-Hexyloxybenzaldehyde; 2-(hexyloxy)benzaldehyde |
Molecular Formula |
C13H18O2 |
Molecular Weight |
206.2808 |
InChI |
InChI=1/C13H18O2/c1-2-3-4-7-10-15-13-9-6-5-8-12(13)11-14/h5-6,8-9,11H,2-4,7,10H2,1H3 |
Molecular Structure |
|
Density |
0.993g/cm3 |
Boiling point |
313.5°C at 760 mmHg |
Refractive index |
1.517 |
Flash point |
130°C |
Vapour Pressur |
0.000494mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|