ChemNet > CAS > 71916-91-1 5-Chloro-2-fluorobenzyl bromide
71916-91-1 5-Chloro-2-fluorobenzyl bromide
| product Name |
5-Chloro-2-fluorobenzyl bromide |
| CAS No |
71916-91-1 |
| Synonyms |
alpha-Bromo-3-chloro-6-fluorotoluene; 2-Fluoro-5-chlorobenzyl bromide; 2-(bromomethyl)-4-chloro-1-fluorobenzene |
| Molecular Formula |
C7H5BrClF |
| Molecular Weight |
223.47 |
| InChI |
InChI=1/C7H5BrClF/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 |
| Molecular Structure |
|
| Density |
1.654g/cm3 |
| Boiling point |
226.7°C at 760 mmHg |
| Refractive index |
1.561 |
| Flash point |
90.9°C |
| Vapour Pressur |
0.121mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
