ChemNet > CAS > 71989-96-3 2,3,4-trimethoxybenzyl alcohol
71989-96-3 2,3,4-trimethoxybenzyl alcohol
| product Name |
2,3,4-trimethoxybenzyl alcohol |
| CAS No |
71989-96-3 |
| Synonyms |
2,3,4-Trimethoxybenzene methanol |
| Molecular Formula |
C10H14O4 |
| Molecular Weight |
198.2158 |
| InChI |
InChI=1/C10H14O4/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5,11H,6H2,1-3H3 |
| EINECS |
276-270-0 |
| Molecular Structure |
|
| Density |
1.131g/cm3 |
| Boiling point |
310.9°C at 760 mmHg |
| Refractive index |
1.513 |
| Flash point |
134.5°C |
| Vapour Pressur |
0.000251mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
