ChemNet > CAS > 7210-77-7 Ethyl 2,4-dimethylthiazole-5-carboxylate
7210-77-7 Ethyl 2,4-dimethylthiazole-5-carboxylate
| product Name |
Ethyl 2,4-dimethylthiazole-5-carboxylate |
| CAS No |
7210-77-7 |
| Synonyms |
ethyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| Molecular Formula |
C8H11NO2S |
| Molecular Weight |
185.2434 |
| InChI |
InChI=1/C8H11NO2S/c1-4-11-8(10)7-5(2)9-6(3)12-7/h4H2,1-3H3 |
| Molecular Structure |
|
| Density |
1.164g/cm3 |
| Melting point |
48℃ |
| Boiling point |
254.341°C at 760 mmHg |
| Refractive index |
1.525 |
| Flash point |
107.622°C |
| Vapour Pressur |
0.017mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
