ChemNet > CAS > 72571-06-3 5-(4-bromophenyl)-1,3-oxazole
72571-06-3 5-(4-bromophenyl)-1,3-oxazole
| product Name |
5-(4-bromophenyl)-1,3-oxazole |
| CAS No |
72571-06-3 |
| Molecular Formula |
C9H6BrNO |
| Molecular Weight |
224.054 |
| InChI |
InChI=1/C9H6BrNO/c10-8-3-1-7(2-4-8)9-5-11-6-12-9/h1-6H |
| Molecular Structure |
|
| Density |
1.524g/cm3 |
| Melting point |
78℃ |
| Boiling point |
315.8°C at 760 mmHg |
| Refractive index |
1.58 |
| Flash point |
144.8°C |
| Vapour Pressur |
0.000794mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
