ChemNet > CAS > 728-87-0 4,4'-Dimethoxybenzhydrol
728-87-0 4,4'-Dimethoxybenzhydrol
| product Name |
4,4'-Dimethoxybenzhydrol |
| CAS No |
728-87-0 |
| Synonyms |
Bis(4-methoxyphenyl) carbinol; 4,4-Dimethoxydiphenylmethanol; 4,4-Dimethoxybenzhydrol; Bis(4-methoxyphenyl)carbinol; bis(4-methoxyphenyl)methanol |
| Molecular Formula |
C15H16O3 |
| Molecular Weight |
244.2857 |
| InChI |
InChI=1/C15H16O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,15-16H,1-2H3 |
| EINECS |
211-975-9 |
| Molecular Structure |
|
| Density |
1.135g/cm3 |
| Melting point |
68-72℃ |
| Boiling point |
406.5°C at 760 mmHg |
| Refractive index |
1.568 |
| Flash point |
199.6°C |
| Vapour Pressur |
2.46E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
