ChemNet > CAS > 72936-74-4 alpha-Pinene oxide
72936-74-4 alpha-Pinene oxide
| product Name |
alpha-Pinene oxide |
| CAS No |
72936-74-4;1686-14-2;74525-43-2 |
| Synonyms |
pin-2(3)-ene oxide; 2,3-epoxypinane; (1S,6S)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.0~2,4~]octane |
| Molecular Formula |
C10H16O |
| Molecular Weight |
152.2334 |
| InChI |
InChI=1/C10H16O/c1-9(2)6-4-7(9)10(3)8(5-6)11-10/h6-8H,4-5H2,1-3H3/t6-,7-,8?,10?/m0/s1 |
| EINECS |
216-869-6 |
| Molecular Structure |
|
| Density |
1.027g/cm3 |
| Boiling point |
188.6°C at 760 mmHg |
| Refractive index |
1.504 |
| Flash point |
65.6°C |
| Vapour Pressur |
0.819mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
