ChemNet > CAS > 73033-58-6 5-Chloro-2-nitrobenzyl alcohol
73033-58-6 5-Chloro-2-nitrobenzyl alcohol
| product Name |
5-Chloro-2-nitrobenzyl alcohol |
| CAS No |
73033-58-6 |
| Synonyms |
(5-chloro-2-nitrophenyl)methanol; 5-Chloro-2-nitrobenzenemethanol |
| Molecular Formula |
C7H6ClNO3 |
| Molecular Weight |
187.5804 |
| InChI |
InChI=1/C7H6ClNO3/c8-6-1-2-7(9(11)12)5(3-6)4-10/h1-3,10H,4H2 |
| EINECS |
277-241-5 |
| Molecular Structure |
|
| Density |
1.476g/cm3 |
| Melting point |
77-82℃ |
| Boiling point |
316.1°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
145°C |
| Vapour Pressur |
0.000176mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
