ChemNet > CAS > 7335-25-3 Ethyl 2-chlorobenzoate
7335-25-3 Ethyl 2-chlorobenzoate
| product Name |
Ethyl 2-chlorobenzoate |
| CAS No |
7335-25-3 |
| Synonyms |
2-Chlorobenzoic acid ethyl ester |
| Molecular Formula |
C9H9ClO2 |
| Molecular Weight |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| EINECS |
230-842-6 |
| Molecular Structure |
|
| Density |
1.185g/cm3 |
| Boiling point |
243.6°C at 760 mmHg |
| Refractive index |
1.522 |
| Flash point |
111.2°C |
| Vapour Pressur |
0.0318mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
