7335-27-5 Ethyl 4-chlorobenzoate
product Name |
Ethyl 4-chlorobenzoate |
CAS No |
7335-27-5 |
Synonyms |
4-Chlorobenzoic acid ethyl ester |
Molecular Formula |
C9H9ClO2 |
Molecular Weight |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
EINECS |
230-844-7 |
Molecular Structure |
|
Density |
1.185g/cm3 |
Boiling point |
238.1°C at 760 mmHg |
Refractive index |
1.522 |
Flash point |
107.2°C |
Vapour Pressur |
0.0432mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|