ChemNet > CAS > 7355-22-8 5-Bromo-§
7355-22-8 5-Bromo-§
| product Name |
5-Bromo-§ |
| CAS No |
7355-22-8 |
| Synonyms |
5-Bromo-2,4-dihydroxybenzoic acid monohydrate; 5-bromo-2,4-dihydroxybenzoic acid |
| Molecular Formula |
C7H5BrO4 |
| Molecular Weight |
233.0162 |
| InChI |
InChI=1/C7H5BrO4/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,9-10H,(H,11,12) |
| EINECS |
230-881-9 |
| Molecular Structure |
|
| Density |
2.026g/cm3 |
| Boiling point |
436.7°C at 760 mmHg |
| Refractive index |
1.703 |
| Flash point |
217.9°C |
| Vapour Pressur |
2.13E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
